C24H24F6N2S — CID 178040066
2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4-[4-(trifluoromethyl)phenyl]sulfanyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 178040066) has the molecular formula C24H24F6N2S and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4-[4-(trifluoromethyl)phenyl]sulfanyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4-[4-(trifluoromethyl)phenyl]sulfanyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178040066 |
| Molecular Formula | C24H24F6N2S |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4-[4-(trifluoromethyl)phenyl]sulfanyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2Sc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F6N2S/c1-3-6-16(14-18(7-4-2)24(28,29)30)20-15-21-22(8-5-13-32(21)31-20)33-19-11-9-17(10-12-19)23(25,26)27/h3,6-7,9-12,14-15,22H,4-5,8,13H2,1-2H3/b6-3-,16-14+,18-7- |
| InChIKey | SVJABNPUNLDGMK-SWAHNTTLSA-N |
| XLogP | 8.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|