C28H36F6N2O — CID 178040823
(2E,4Z,6Z)-6-(trifluoromethyl)deca-2,4,6-trien-2-ol;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 178040823) has the molecular formula C28H36F6N2O and a molecular weight of 530.60 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-(trifluoromethyl)deca-2,4,6-trien-2-ol;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | (2E,4Z,6Z)-6-(trifluoromethyl)deca-2,4,6-trien-2-ol;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178040823 |
| Molecular Formula | C28H36F6N2O |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (2E,4Z,6Z)-6-(trifluoromethyl)deca-2,4,6-trien-2-ol;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2.CCC/C=C(/C=C\C=C(/C)O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2.C11H15F3O/c1-3-7-13(11-14(8-4-2)17(18,19)20)16-12-15-9-5-6-10-22(15)21-16;1-3-4-7-10(11(12,13)14)8-5-6-9(2)15/h3,7-8,11-12H,4-6,9-10H2,1-2H3;5-8,15H,3-4H2,1-2H3/b7-3-,13-11+,14-8-;8-5-,9-6+,10-7- |
| InChIKey | FLYSGWDVVJMHHD-VWIONSQYSA-N |
| XLogP | 9.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|