C28H38F3N3O — CID 178040644
N-[(2E,4Z,6Z)-6-ethoxynona-2,4,6-trien-2-yl]-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine (PubChem CID 178040644) has the molecular formula C28H38F3N3O and a molecular weight of 489.63 g/mol. Its IUPAC name is N-[(2E,4Z,6Z)-6-ethoxynona-2,4,6-trien-2-yl]-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine.
| Compound Name | N-[(2E,4Z,6Z)-6-ethoxynona-2,4,6-trien-2-yl]-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine |
|---|---|
| PubChem CID | 178040644 |
| Molecular Formula | C28H38F3N3O |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | N-[(2E,4Z,6Z)-6-ethoxynona-2,4,6-trien-2-yl]-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2N/C(C)=C/C=C\C(=C\CC)OCC |
| InChI | InChI=1S/C28H38F3N3O/c1-6-12-22(19-23(13-7-2)28(29,30)31)26-20-27-25(17-11-18-34(27)33-26)32-21(5)15-10-16-24(14-8-3)35-9-4/h6,10,12-16,19-20,25,32H,7-9,11,17-18H2,1-5H3/b12-6-,16-10-,21-15+,22-19+,23-13-,24-14- |
| InChIKey | WUWBMHVKHAXXSX-KSVOXYFWSA-N |
| XLogP | 7.96 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|