C23H27F3N4 — CID 178040632
N-methyl-N-pyridin-2-yl-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine (PubChem CID 178040632) has the molecular formula C23H27F3N4 and a molecular weight of 416.49 g/mol. Its IUPAC name is N-methyl-N-pyridin-2-yl-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine.
| Compound Name | N-methyl-N-pyridin-2-yl-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine |
|---|---|
| PubChem CID | 178040632 |
| Molecular Formula | C23H27F3N4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-methyl-N-pyridin-2-yl-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2N(C)c1ccccn1 |
| InChI | InChI=1S/C23H27F3N4/c1-4-9-17(15-18(10-5-2)23(24,25)26)19-16-21-20(11-8-14-30(21)28-19)29(3)22-12-6-7-13-27-22/h4,6-7,9-10,12-13,15-16,20H,5,8,11,14H2,1-3H3/b9-4-,17-15+,18-10- |
| InChIKey | OASSGKPMZFWNSO-PMZYCXHMSA-N |
| XLogP | 6.11 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|