C17H20F4N2 — CID 178040173
2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 178040173) has the molecular formula C17H20F4N2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178040173 |
| Molecular Formula | C17H20F4N2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | C/C=C(F)\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C17H20F4N2/c1-3-7-12(17(19,20)21)10-14(15(18)4-2)16-11-13-8-5-6-9-23(13)22-16/h4,7,10-11H,3,5-6,8-9H2,1-2H3/b12-7-,14-10+,15-4+ |
| InChIKey | UWHUCLBIHOTFLL-KUMRJNKRSA-N |
| XLogP | 5.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|