C23H27F3N2O3 — CID 178040375
2-methoxy-1H-pyridin-4-one;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 178040375) has the molecular formula C23H27F3N2O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-methoxy-1H-pyridin-4-one;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 2-methoxy-1H-pyridin-4-one;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 178040375 |
| Molecular Formula | C23H27F3N2O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-methoxy-1H-pyridin-4-one;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1nc2c(o1)CCCC2.COc1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C17H20F3NO.C6H7NO2/c1-3-7-12(11-13(8-4-2)17(18,19)20)16-21-14-9-5-6-10-15(14)22-16;1-9-6-4-5(8)2-3-7-6/h3,7-8,11H,4-6,9-10H2,1-2H3;2-4H,1H3,(H,7,8)/b7-3-,12-11+,13-8-; |
| InChIKey | MFNHKMNTWXQWRX-OVHXEYJRSA-N |
| XLogP | 5.80 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|