C19H34O5 — CID 123791961
[2-hydroxy-1-(7-hydroxy-4,5,5,6,6-pentamethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-methylpropyl] acetate (PubChem CID 123791961) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is [2-hydroxy-1-(7-hydroxy-4,5,5,6,6-pentamethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-methylpropyl] acetate.
| Compound Name | [2-hydroxy-1-(7-hydroxy-4,5,5,6,6-pentamethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 123791961 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [2-hydroxy-1-(7-hydroxy-4,5,5,6,6-pentamethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-methylpropyl] acetate |
| SMILES | CC(=O)OC(C1CC(C)C2C(O1)C(O)C(C)(C)C2(C)C)C(C)(C)O |
| InChI | InChI=1S/C19H34O5/c1-10-9-12(16(19(7,8)22)23-11(2)20)24-14-13(10)17(3,4)18(5,6)15(14)21/h10,12-16,21-22H,9H2,1-8H3 |
| InChIKey | SKGXPUDNZSTIOM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |