C21H38F2O3 — CID 123950910
6-butan-2-yl-2-(1,1-difluoro-2-hydroxy-2-methylpropyl)-5-ethyl-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol (PubChem CID 123950910) has the molecular formula C21H38F2O3 and a molecular weight of 376.53 g/mol. Its IUPAC name is 6-butan-2-yl-2-(1,1-difluoro-2-hydroxy-2-methylpropyl)-5-ethyl-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol.
| Compound Name | 6-butan-2-yl-2-(1,1-difluoro-2-hydroxy-2-methylpropyl)-5-ethyl-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol |
|---|---|
| PubChem CID | 123950910 |
| Molecular Formula | C21H38F2O3 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 6-butan-2-yl-2-(1,1-difluoro-2-hydroxy-2-methylpropyl)-5-ethyl-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol |
| SMILES | CCC(C)C1(C)C(O)C2OC(C(F)(F)C(C)(C)O)CC(C)C2C1(C)CC |
| InChI | InChI=1S/C21H38F2O3/c1-9-13(4)20(8)17(24)16-15(19(20,7)10-2)12(3)11-14(26-16)21(22,23)18(5,6)25/h12-17,24-25H,9-11H2,1-8H3 |
| InChIKey | BHDQZNYPVFTCAA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |