C23H41O5- — CID 123832100
[1-(6-butan-2-yl-5-ethyl-7-hydroxy-6-methanidyl-4,5-dimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate (PubChem CID 123832100) has the molecular formula C23H41O5- and a molecular weight of 397.58 g/mol. Its IUPAC name is [1-(6-butan-2-yl-5-ethyl-7-hydroxy-6-methanidyl-4,5-dimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate.
| Compound Name | [1-(6-butan-2-yl-5-ethyl-7-hydroxy-6-methanidyl-4,5-dimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 123832100 |
| Molecular Formula | C23H41O5- |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | [1-(6-butan-2-yl-5-ethyl-7-hydroxy-6-methanidyl-4,5-dimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate |
| SMILES | [CH2-]C1(C(C)CC)C(O)C2OC(C(OC(C)=O)C(C)(C)O)CC(C)C2C1(C)CC |
| InChI | InChI=1S/C23H41O5/c1-10-14(4)23(9)19(25)18-17(22(23,8)11-2)13(3)12-16(28-18)20(21(6,7)26)27-15(5)24/h13-14,16-20,25-26H,9-12H2,1-8H3/q-1 |
| InChIKey | CODOXQKEHHETQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|