C21H39FO3 — CID 123391589
6-butan-2-yl-5-ethyl-2-(1-fluoro-2-hydroxy-2-methylpropyl)-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol (PubChem CID 123391589) has the molecular formula C21H39FO3 and a molecular weight of 358.54 g/mol. Its IUPAC name is 6-butan-2-yl-5-ethyl-2-(1-fluoro-2-hydroxy-2-methylpropyl)-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol.
| Compound Name | 6-butan-2-yl-5-ethyl-2-(1-fluoro-2-hydroxy-2-methylpropyl)-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol |
|---|---|
| PubChem CID | 123391589 |
| Molecular Formula | C21H39FO3 |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 6-butan-2-yl-5-ethyl-2-(1-fluoro-2-hydroxy-2-methylpropyl)-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-7-ol |
| SMILES | CCC(C)C1(C)C(O)C2OC(C(F)C(C)(C)O)CC(C)C2C1(C)CC |
| InChI | InChI=1S/C21H39FO3/c1-9-13(4)21(8)18(23)16-15(20(21,7)10-2)12(3)11-14(25-16)17(22)19(5,6)24/h12-18,23-24H,9-11H2,1-8H3 |
| InChIKey | GKBKMHSVLNBNKN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |