C21H37FO4 — CID 123619827
[1-(6-butan-2-yl-5-ethyl-7-hydroxy-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-fluoroethyl] acetate (PubChem CID 123619827) has the molecular formula C21H37FO4 and a molecular weight of 372.52 g/mol. Its IUPAC name is [1-(6-butan-2-yl-5-ethyl-7-hydroxy-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-fluoroethyl] acetate.
| Compound Name | [1-(6-butan-2-yl-5-ethyl-7-hydroxy-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-fluoroethyl] acetate |
|---|---|
| PubChem CID | 123619827 |
| Molecular Formula | C21H37FO4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [1-(6-butan-2-yl-5-ethyl-7-hydroxy-4,5,6-trimethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-fluoroethyl] acetate |
| SMILES | CCC(C)C1(C)C(O)C2OC(C(CF)OC(C)=O)CC(C)C2C1(C)CC |
| InChI | InChI=1S/C21H37FO4/c1-8-13(4)21(7)19(24)18-17(20(21,6)9-2)12(3)10-15(26-18)16(11-22)25-14(5)23/h12-13,15-19,24H,8-11H2,1-7H3 |
| InChIKey | ASERAHRGWKYVJH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |