C21H36F2O4 — CID 123552585
[1-(7,7-difluoro-4,5,5,6-tetramethyl-6-propan-2-yl-3,4,4a,7a-tetrahydro-2H-cyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate (PubChem CID 123552585) has the molecular formula C21H36F2O4 and a molecular weight of 390.51 g/mol. Its IUPAC name is [1-(7,7-difluoro-4,5,5,6-tetramethyl-6-propan-2-yl-3,4,4a,7a-tetrahydro-2H-cyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate.
| Compound Name | [1-(7,7-difluoro-4,5,5,6-tetramethyl-6-propan-2-yl-3,4,4a,7a-tetrahydro-2H-cyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 123552585 |
| Molecular Formula | C21H36F2O4 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [1-(7,7-difluoro-4,5,5,6-tetramethyl-6-propan-2-yl-3,4,4a,7a-tetrahydro-2H-cyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] acetate |
| SMILES | CC(=O)OC(C1CC(C)C2C(O1)C(F)(F)C(C)(C(C)C)C2(C)C)C(C)(C)O |
| InChI | InChI=1S/C21H36F2O4/c1-11(2)20(9)18(5,6)15-12(3)10-14(27-17(15)21(20,22)23)16(19(7,8)25)26-13(4)24/h11-12,14-17,25H,10H2,1-9H3 |
| InChIKey | XHZZKCBFEGXALA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |