C21H38O5 — CID 123889801
[1-(6-ethyl-7-hydroxy-4,5,5,6-tetramethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] propanoate (PubChem CID 123889801) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is [1-(6-ethyl-7-hydroxy-4,5,5,6-tetramethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] propanoate.
| Compound Name | [1-(6-ethyl-7-hydroxy-4,5,5,6-tetramethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] propanoate |
|---|---|
| PubChem CID | 123889801 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [1-(6-ethyl-7-hydroxy-4,5,5,6-tetramethyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyran-2-yl)-2-hydroxy-2-methylpropyl] propanoate |
| SMILES | CCC(=O)OC(C1CC(C)C2C(O1)C(O)C(C)(CC)C2(C)C)C(C)(C)O |
| InChI | InChI=1S/C21H38O5/c1-9-14(22)26-18(20(6,7)24)13-11-12(3)15-16(25-13)17(23)21(8,10-2)19(15,4)5/h12-13,15-18,23-24H,9-11H2,1-8H3 |
| InChIKey | ZPHXMDJDJNVQSA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |