C14H26 — CID 123792148
1,2,4-trimethyl-6-prop-1-enylcyclooctane (PubChem CID 123792148) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1,2,4-trimethyl-6-prop-1-enylcyclooctane.
| Compound Name | 1,2,4-trimethyl-6-prop-1-enylcyclooctane |
|---|---|
| PubChem CID | 123792148 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1,2,4-trimethyl-6-prop-1-enylcyclooctane |
| SMILES | CC=CC1CCC(C)C(C)CC(C)C1 |
| InChI | InChI=1S/C14H26/c1-5-6-14-8-7-12(3)13(4)9-11(2)10-14/h5-6,11-14H,7-10H2,1-4H3 |
| InChIKey | IGDFDRAQTKHTJH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|