C24H39N7O — CID 123795848
2-[1-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-(2-oxoundecyl)phenyl]ethylideneamino]ethanimidamide (PubChem CID 123795848) has the molecular formula C24H39N7O and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[1-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-(2-oxoundecyl)phenyl]ethylideneamino]ethanimidamide.
| Compound Name | 2-[1-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-(2-oxoundecyl)phenyl]ethylideneamino]ethanimidamide |
|---|---|
| PubChem CID | 123795848 |
| Molecular Formula | C24H39N7O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 2-[1-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-(2-oxoundecyl)phenyl]ethylideneamino]ethanimidamide |
| SMILES | [H]/N=C(\N)C/N=C(\C)c1cc(CC(=O)CCCCCCCCC)cc(/C(C)=N\N=C(N)N)c1 |
| InChI | InChI=1S/C24H39N7O/c1-4-5-6-7-8-9-10-11-22(32)14-19-12-20(17(2)29-16-23(25)26)15-21(13-19)18(3)30-31-24(27)28/h12-13,15H,4-11,14,16H2,1-3H3,(H3,25,26)(H4,27,28,31)/b29-17+,30-18- |
| InChIKey | ISXDSKVXKVFGDN-AFVORURQSA-N |
| XLogP | 3.68 |
| TPSA | 156.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|