C20H40S — CID 123796110
3,4-dimethyl-4-(3-methylbutan-2-yl)-1-propan-2-ylsulfanyldec-2-ene (PubChem CID 123796110) has the molecular formula C20H40S and a molecular weight of 312.61 g/mol. Its IUPAC name is 3,4-dimethyl-4-(3-methylbutan-2-yl)-1-propan-2-ylsulfanyldec-2-ene.
| Compound Name | 3,4-dimethyl-4-(3-methylbutan-2-yl)-1-propan-2-ylsulfanyldec-2-ene |
|---|---|
| PubChem CID | 123796110 |
| Molecular Formula | C20H40S |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | 3,4-dimethyl-4-(3-methylbutan-2-yl)-1-propan-2-ylsulfanyldec-2-ene |
| SMILES | CCCCCCC(C)(C(C)=CCSC(C)C)C(C)C(C)C |
| InChI | InChI=1S/C20H40S/c1-9-10-11-12-14-20(8,19(7)16(2)3)18(6)13-15-21-17(4)5/h13,16-17,19H,9-12,14-15H2,1-8H3 |
| InChIKey | AAJWEXRPPVKVAW-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|