C26H35NO5 — CID 123797647
benzyl 7-hydroxy-3-(1-oxotridec-7-en-5-ylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 123797647) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is benzyl 7-hydroxy-3-(1-oxotridec-7-en-5-ylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl 7-hydroxy-3-(1-oxotridec-7-en-5-ylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 123797647 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | benzyl 7-hydroxy-3-(1-oxotridec-7-en-5-ylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCC=CCC(CCCC=O)=C1OC2CC(O)N2C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35NO5/c1-2-3-4-5-6-10-15-21(16-11-12-17-28)25-24(27-22(29)18-23(27)32-25)26(30)31-19-20-13-8-7-9-14-20/h6-10,13-14,17,22-24,29H,2-5,11-12,15-16,18-19H2,1H3 |
| InChIKey | FRUYAGGRTYCPQQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|