C34H42N2O8 — CID 123798274
[4-[(E)-[3-[(E)-3-[4-(2-amino-3-methylbutanoyl)oxy-3-methoxyphenyl]prop-2-enoyl]-2-oxocyclohexylidene]methyl]-2-(hydroxymethyl)phenyl] 2-amino-3-methylbutanoate (PubChem CID 123798274) has the molecular formula C34H42N2O8 and a molecular weight of 606.72 g/mol. Its IUPAC name is [4-[(E)-[3-[(E)-3-[4-(2-amino-3-methylbutanoyl)oxy-3-methoxyphenyl]prop-2-enoyl]-2-oxocyclohexylidene]methyl]-2-(hydroxymethyl)phenyl] 2-amino-3-methylbutanoate.
| Compound Name | [4-[(E)-[3-[(E)-3-[4-(2-amino-3-methylbutanoyl)oxy-3-methoxyphenyl]prop-2-enoyl]-2-oxocyclohexylidene]methyl]-2-(hydroxymethyl)phenyl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 123798274 |
| Molecular Formula | C34H42N2O8 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | [4-[(E)-[3-[(E)-3-[4-(2-amino-3-methylbutanoyl)oxy-3-methoxyphenyl]prop-2-enoyl]-2-oxocyclohexylidene]methyl]-2-(hydroxymethyl)phenyl] 2-amino-3-methylbutanoate |
| SMILES | COc1cc(/C=C/C(=O)C2CCC/C(=C\c3ccc(OC(=O)C(N)C(C)C)c(CO)c3)C2=O)ccc1OC(=O)C(N)C(C)C |
| InChI | InChI=1S/C34H42N2O8/c1-19(2)30(35)33(40)43-27-13-11-22(16-24(27)18-37)15-23-7-6-8-25(32(23)39)26(38)12-9-21-10-14-28(29(17-21)42-5)44-34(41)31(36)20(3)4/h9-17,19-20,25,30-31,37H,6-8,18,35-36H2,1-5H3/b12-9+,23-15+ |
| InChIKey | POQRPMGJACTAFA-KKTPBOSZSA-N |
| XLogP | 4.00 |
| TPSA | 168.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|