C36H48N4O8 — CID 66742305
[4-[3-[3-[[4-(2,6-diaminohexanoyloxy)-3-methoxyphenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,6-diaminohexanoate (PubChem CID 66742305) has the molecular formula C36H48N4O8 and a molecular weight of 664.80 g/mol. Its IUPAC name is [4-[3-[3-[[4-(2,6-diaminohexanoyloxy)-3-methoxyphenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,6-diaminohexanoate.
| Compound Name | [4-[3-[3-[[4-(2,6-diaminohexanoyloxy)-3-methoxyphenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 66742305 |
| Molecular Formula | C36H48N4O8 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | [4-[3-[3-[[4-(2,6-diaminohexanoyloxy)-3-methoxyphenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,6-diaminohexanoate |
| SMILES | COc1cc(C=CC(=O)C2CCCC(=Cc3ccc(OC(=O)C(N)CCCCN)c(OC)c3)C2=O)ccc1OC(=O)C(N)CCCCN |
| InChI | InChI=1S/C36H48N4O8/c1-45-32-21-23(13-16-30(32)47-35(43)27(39)10-3-5-18-37)12-15-29(41)26-9-7-8-25(34(26)42)20-24-14-17-31(33(22-24)46-2)48-36(44)28(40)11-4-6-19-38/h12-17,20-22,26-28H,3-11,18-19,37-40H2,1-2H3 |
| InChIKey | BZWFURDZEGKGTP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 209.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|