C20H31N5O8 — CID 89021017
[4-[(E)-3-[4-(dihydroxyamino)oxybutoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 89021017) has the molecular formula C20H31N5O8 and a molecular weight of 469.50 g/mol. Its IUPAC name is [4-[(E)-3-[4-(dihydroxyamino)oxybutoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [4-[(E)-3-[4-(dihydroxyamino)oxybutoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 89021017 |
| Molecular Formula | C20H31N5O8 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | [4-[(E)-3-[4-(dihydroxyamino)oxybutoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCON(O)O)ccc1OC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C20H31N5O8/c1-30-17-13-14(7-9-18(26)31-11-2-3-12-32-25(28)29)6-8-16(17)33-19(27)15(21)5-4-10-24-20(22)23/h6-9,13,15,28-29H,2-5,10-12,21H2,1H3,(H4,22,23,24)/b9-7+ |
| InChIKey | DQWBVURIPFUBDH-VQHVLOKHSA-N |
| XLogP | 0.33 |
| TPSA | 205.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|