C28H41N7O2SSi — CID 123800305
1-[3-[[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]piperidin-1-yl]ethanone (PubChem CID 123800305) has the molecular formula C28H41N7O2SSi and a molecular weight of 567.84 g/mol. Its IUPAC name is 1-[3-[[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 123800305 |
| Molecular Formula | C28H41N7O2SSi |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 1-[3-[[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(Nc2cnc3ccc(N(COCC[Si](C)(C)C)c4nnc(C5CCCC5)s4)nc3c2)C1 |
| InChI | InChI=1S/C28H41N7O2SSi/c1-20(36)34-13-7-10-22(18-34)30-23-16-25-24(29-17-23)11-12-26(31-25)35(19-37-14-15-39(2,3)4)28-33-32-27(38-28)21-8-5-6-9-21/h11-12,16-17,21-22,30H,5-10,13-15,18-19H2,1-4H3 |
| InChIKey | CIVARUJFRNUMGK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|