C28H37N7O2SSi — CID 157227923
4-[4-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]pyrazol-1-yl]butan-2-one (PubChem CID 157227923) has the molecular formula C28H37N7O2SSi and a molecular weight of 563.80 g/mol. Its IUPAC name is 4-[4-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]pyrazol-1-yl]butan-2-one.
| Compound Name | 4-[4-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]pyrazol-1-yl]butan-2-one |
|---|---|
| PubChem CID | 157227923 |
| Molecular Formula | C28H37N7O2SSi |
| Molecular Weight | 563.80 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 4-[4-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]pyrazol-1-yl]butan-2-one |
| SMILES | CC(=O)CCn1cc(-c2cnc3ccc(N(COCC[Si](C)(C)C)c4nnc(C5CCCC5)s4)nc3c2)cn1 |
| InChI | InChI=1S/C28H37N7O2SSi/c1-20(36)11-12-34-18-23(17-30-34)22-15-25-24(29-16-22)9-10-26(31-25)35(19-37-13-14-39(2,3)4)28-33-32-27(38-28)21-7-5-6-8-21/h9-10,15-18,21H,5-8,11-14,19H2,1-4H3 |
| InChIKey | PESCLLZSWBIMQG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|