C19H32O2 — CID 123800840
2-(7-methoxy-4-methylideneocta-5,7-dien-3-yl)oxypropan-2-ylcyclohexane (PubChem CID 123800840) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-(7-methoxy-4-methylideneocta-5,7-dien-3-yl)oxypropan-2-ylcyclohexane.
| Compound Name | 2-(7-methoxy-4-methylideneocta-5,7-dien-3-yl)oxypropan-2-ylcyclohexane |
|---|---|
| PubChem CID | 123800840 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-(7-methoxy-4-methylideneocta-5,7-dien-3-yl)oxypropan-2-ylcyclohexane |
| SMILES | C=C(C=CC(=C)C(CC)OC(C)(C)C1CCCCC1)OC |
| InChI | InChI=1S/C19H32O2/c1-7-18(15(2)13-14-16(3)20-6)21-19(4,5)17-11-9-8-10-12-17/h13-14,17-18H,2-3,7-12H2,1,4-6H3 |
| InChIKey | BNEDEKSQONFGOY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|