C23H20FN3O4 — CID 123811346
1-[4-amino-1-(4-fluorophenyl)-1,4-dioxobutan-2-yl]-1,2,5,6-tetrahydroazepino[4,5-b]indole-5-carboxylic acid (PubChem CID 123811346) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is 1-[4-amino-1-(4-fluorophenyl)-1,4-dioxobutan-2-yl]-1,2,5,6-tetrahydroazepino[4,5-b]indole-5-carboxylic acid.
| Compound Name | 1-[4-amino-1-(4-fluorophenyl)-1,4-dioxobutan-2-yl]-1,2,5,6-tetrahydroazepino[4,5-b]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 123811346 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-[4-amino-1-(4-fluorophenyl)-1,4-dioxobutan-2-yl]-1,2,5,6-tetrahydroazepino[4,5-b]indole-5-carboxylic acid |
| SMILES | NC(=O)CC(C(=O)c1ccc(F)cc1)C1CN=CC(C(=O)O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C23H20FN3O4/c24-13-7-5-12(6-8-13)22(29)15(9-19(25)28)16-10-26-11-17(23(30)31)21-20(16)14-3-1-2-4-18(14)27-21/h1-8,11,15-17,27H,9-10H2,(H2,25,28)(H,30,31) |
| InChIKey | FMMYDYBINNBPJF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |