C12H18 — CID 123813871
2,8-dimethyltetracyclo[4.2.1.13,5.01,7]decane (PubChem CID 123813871) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 2,8-dimethyltetracyclo[4.2.1.13,5.01,7]decane.
| Compound Name | 2,8-dimethyltetracyclo[4.2.1.13,5.01,7]decane |
|---|---|
| PubChem CID | 123813871 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2,8-dimethyltetracyclo[4.2.1.13,5.01,7]decane |
| SMILES | CC1C2CC(C2)C2CC13C(C)C23 |
| InChI | InChI=1S/C12H18/c1-6-8-3-9(4-8)10-5-12(6)7(2)11(10)12/h6-11H,3-5H2,1-2H3 |
| InChIKey | OMTXRSXPVJPIKD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |