C10H15N — CID 57338028
(1R,8S)-tetracyclo[4.3.1.02,4.03,8]decan-6-amine (PubChem CID 57338028) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (1R,8S)-tetracyclo[4.3.1.02,4.03,8]decan-6-amine.
| Compound Name | (1R,8S)-tetracyclo[4.3.1.02,4.03,8]decan-6-amine |
|---|---|
| PubChem CID | 57338028 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (1R,8S)-tetracyclo[4.3.1.02,4.03,8]decan-6-amine |
| SMILES | NC12CC3C4C3[C@@H](C[C@@H]4C1)C2 |
| InChI | InChI=1S/C10H15N/c11-10-2-5-1-6(3-10)9-7(4-10)8(5)9/h5-9H,1-4,11H2/t5-,6+,7?,8?,9?,10? |
| InChIKey | CHNSBTFEBBYKOL-WFDLZMKCSA-N |
| XLogP | 1.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |