C11H18N2 — CID 162136743
(6S)-tetracyclo[6.2.1.03,10.04,6]undecane-4,8-diamine (PubChem CID 162136743) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (6S)-tetracyclo[6.2.1.03,10.04,6]undecane-4,8-diamine.
| Compound Name | (6S)-tetracyclo[6.2.1.03,10.04,6]undecane-4,8-diamine |
|---|---|
| PubChem CID | 162136743 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (6S)-tetracyclo[6.2.1.03,10.04,6]undecane-4,8-diamine |
| SMILES | NC12CC3CC(C3C1)C1(N)CC1C2 |
| InChI | InChI=1S/C11H18N2/c12-10-2-6-1-9(8(6)5-10)11(13)4-7(11)3-10/h6-9H,1-5,12-13H2 |
| InChIKey | ZJJVHDSYZZCEPP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |