C10H17N — CID 123657337
tricyclo[5.2.1.03,8]decan-1-amine (PubChem CID 123657337) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is tricyclo[5.2.1.03,8]decan-1-amine.
| Compound Name | tricyclo[5.2.1.03,8]decan-1-amine |
|---|---|
| PubChem CID | 123657337 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | tricyclo[5.2.1.03,8]decan-1-amine |
| SMILES | NC12CC3CCCC(C1)C3C2 |
| InChI | InChI=1S/C10H17N/c11-10-4-7-2-1-3-8(5-10)9(7)6-10/h7-9H,1-6,11H2 |
| InChIKey | WHRSHKQQLFWSQY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |