C12H22N2O3 — CID 153378475
2-amino-1-[3-(hydroxyamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (PubChem CID 153378475) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-amino-1-[3-(hydroxyamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid.
| Compound Name | 2-amino-1-[3-(hydroxyamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 153378475 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-amino-1-[3-(hydroxyamino)propyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| SMILES | NC1(C(=O)O)CC2CCCC2C1CCCNO |
| InChI | InChI=1S/C12H22N2O3/c13-12(11(15)16)7-8-3-1-4-9(8)10(12)5-2-6-14-17/h8-10,14,17H,1-7,13H2,(H,15,16) |
| InChIKey | WBDBCXVXFPACKR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|