C11H15NS — CID 3656227
tetracyclo[4.3.1.02,4.03,8]decane-6-carbothioamide (PubChem CID 3656227) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is tetracyclo[4.3.1.02,4.03,8]decane-6-carbothioamide.
| Compound Name | tetracyclo[4.3.1.02,4.03,8]decane-6-carbothioamide |
|---|---|
| PubChem CID | 3656227 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | tetracyclo[4.3.1.02,4.03,8]decane-6-carbothioamide |
| SMILES | NC(=S)C12CC3CC(C1)C1C(C2)C31 |
| InChI | InChI=1S/C11H15NS/c12-10(13)11-2-5-1-6(3-11)9-7(4-11)8(5)9/h5-9H,1-4H2,(H2,12,13) |
| InChIKey | VYOPCQWVOLQOFQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|