C20H25N3O7 — CID 123815554
[(3S,4R)-4-acetyloxy-5-azido-3-(5-methyl-2-phenyl-1,3-dioxolan-4-yl)oxan-2-yl]methyl acetate (PubChem CID 123815554) has the molecular formula C20H25N3O7 and a molecular weight of 419.43 g/mol. Its IUPAC name is [(3S,4R)-4-acetyloxy-5-azido-3-(5-methyl-2-phenyl-1,3-dioxolan-4-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R)-4-acetyloxy-5-azido-3-(5-methyl-2-phenyl-1,3-dioxolan-4-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123815554 |
| Molecular Formula | C20H25N3O7 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(3S,4R)-4-acetyloxy-5-azido-3-(5-methyl-2-phenyl-1,3-dioxolan-4-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OCC(N=[N+]=[N-])[C@H](OC(C)=O)[C@@H]1C1OC(c2ccccc2)OC1C |
| InChI | InChI=1S/C20H25N3O7/c1-11-18(30-20(28-11)14-7-5-4-6-8-14)17-16(10-26-12(2)24)27-9-15(22-23-21)19(17)29-13(3)25/h4-8,11,15-20H,9-10H2,1-3H3/t11?,15?,16?,17-,18?,19-,20?/m0/s1 |
| InChIKey | MPJWQKOQCJYQAC-GQSGHVAESA-N |
| XLogP | 2.68 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|