C22H22Si — CID 123817246
anthracen-9-yl-dimethyl-(3-methylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123817246) has the molecular formula C22H22Si and a molecular weight of 314.50 g/mol. Its IUPAC name is anthracen-9-yl-dimethyl-(3-methylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | anthracen-9-yl-dimethyl-(3-methylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123817246 |
| Molecular Formula | C22H22Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | anthracen-9-yl-dimethyl-(3-methylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=CCC([Si](C)(C)c2c3ccccc3cc3ccccc23)=C1 |
| InChI | InChI=1S/C22H22Si/c1-16-12-13-19(14-16)23(2,3)22-20-10-6-4-8-17(20)15-18-9-5-7-11-21(18)22/h4-12,14-15H,13H2,1-3H3 |
| InChIKey | OSPGNGGPOHCQQB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|