C9H14O — CID 123819702
4-ethyl-2,4-dimethylpyran (PubChem CID 123819702) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-ethyl-2,4-dimethylpyran.
| Compound Name | 4-ethyl-2,4-dimethylpyran |
|---|---|
| PubChem CID | 123819702 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 4-ethyl-2,4-dimethylpyran |
| SMILES | CCC1(C)C=COC(C)=C1 |
| InChI | InChI=1S/C9H14O/c1-4-9(3)5-6-10-8(2)7-9/h5-7H,4H2,1-3H3 |
| InChIKey | KHYKZLZYFDCXAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |