About 4-ethyl-2,4-dimethylpyran
4-ethyl-2,4-dimethylpyran (PubChem CID 123819702) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-ethyl-2,4-dimethylpyran.
Molecular Properties
| Compound Name | 4-ethyl-2,4-dimethylpyran |
| PubChem CID | 123819702 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 4-ethyl-2,4-dimethylpyran |
| SMILES | CCC1(C)C=COC(C)=C1 |
| InChI | InChI=1S/C9H14O/c1-4-9(3)5-6-10-8(2)7-9/h5-7H,4H2,1-3H3 |
| InChIKey | KHYKZLZYFDCXAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2,4-dimethylpyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,4-dimethylpyran?
The IUPAC name of 4-ethyl-2,4-dimethylpyran (CID 123819702) is 4-ethyl-2,4-dimethylpyran.
What is the SMILES notation for 4-ethyl-2,4-dimethylpyran?
The canonical SMILES for 4-ethyl-2,4-dimethylpyran is CCC1(C)C=COC(C)=C1.
What is the InChIKey of 4-ethyl-2,4-dimethylpyran?
The InChIKey is KHYKZLZYFDCXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-4-9(3)5-6-10-8(2)7-9/h5-7H,4H2,1-3H3.
What are the key properties of 4-ethyl-2,4-dimethylpyran?
4-ethyl-2,4-dimethylpyran has a molecular weight of 138.21 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,4-dimethylpyran is sourced from PubChem (CID 123819702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).