C7H6F2N- — CID 123820021
(2,5-difluorophenyl)-methylazanide (PubChem CID 123820021) has the molecular formula C7H6F2N- and a molecular weight of 142.13 g/mol. Its IUPAC name is (2,5-difluorophenyl)-methylazanide.
| Compound Name | (2,5-difluorophenyl)-methylazanide |
|---|---|
| PubChem CID | 123820021 |
| Molecular Formula | C7H6F2N- |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (2,5-difluorophenyl)-methylazanide |
| SMILES | C[N-]c1cc(F)ccc1F |
| InChI | InChI=1S/C7H6F2N/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,1H3/q-1 |
| InChIKey | ZTGWUZPGSHFUJJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |