C18H33FN4O2 — CID 123830029
ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate (PubChem CID 123830029) has the molecular formula C18H33FN4O2 and a molecular weight of 356.49 g/mol. Its IUPAC name is ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 123830029 |
| Molecular Formula | C18H33FN4O2 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(F)(/C(N)=N/C(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H33FN4O2/c1-4-25-17(24)23-10-5-6-15(7-11-23)22-12-8-18(19,9-13-22)16(20)21-14(2)3/h14-15H,4-13H2,1-3H3,(H2,20,21) |
| InChIKey | HNYASWXMKROMGN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|