About ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate
ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate (PubChem CID 123830029) has the molecular formula C18H33FN4O2
and a molecular weight of 356.49 g/mol. Its IUPAC name is ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate |
| PubChem CID | 123830029 |
| Molecular Formula | C18H33FN4O2 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(F)(/C(N)=N/C(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H33FN4O2/c1-4-25-17(24)23-10-5-6-15(7-11-23)22-12-8-18(19,9-13-22)16(20)21-14(2)3/h14-15H,4-13H2,1-3H3,(H2,20,21) |
| InChIKey | HNYASWXMKROMGN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate?
The IUPAC name of ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate (CID 123830029) is ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate.
What is the SMILES notation for ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate?
The canonical SMILES for ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate is CCOC(=O)N1CCCC(N2CCC(F)(/C(N)=N/C(C)C)CC2)CC1.
What is the InChIKey of ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate?
The InChIKey is HNYASWXMKROMGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33FN4O2/c1-4-25-17(24)23-10-5-6-15(7-11-23)22-12-8-18(19,9-13-22)16(20)21-14(2)3/h14-15H,4-13H2,1-3H3,(H2,20,21).
What are the key properties of ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate?
ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate has a molecular weight of 356.49 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-fluoro-4-(N'-propan-2-ylcarbamimidoyl)piperidin-1-yl]azepane-1-carboxylate is sourced from PubChem (CID 123830029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).