C15H14N2O4 — CID 123831017
ethyl 2-cyano-3-(7-methoxy-2-methyl-1,3-benzoxazol-5-yl)prop-2-enoate (PubChem CID 123831017) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is ethyl 2-cyano-3-(7-methoxy-2-methyl-1,3-benzoxazol-5-yl)prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-(7-methoxy-2-methyl-1,3-benzoxazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 123831017 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | ethyl 2-cyano-3-(7-methoxy-2-methyl-1,3-benzoxazol-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(OC)c2oc(C)nc2c1 |
| InChI | InChI=1S/C15H14N2O4/c1-4-20-15(18)11(8-16)5-10-6-12-14(13(7-10)19-3)21-9(2)17-12/h5-7H,4H2,1-3H3 |
| InChIKey | HTMFBXVNKFDKGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|