C18H23F2N5O2 — CID 123832029
2-[6-(3,3-difluoropyrrolidin-1-yl)pyrimidine-4-carboximidoyl]-4-(2-methoxyethoxy)cyclohexa-2,4-dien-1-amine (PubChem CID 123832029) has the molecular formula C18H23F2N5O2 and a molecular weight of 379.41 g/mol. Its IUPAC name is 2-[6-(3,3-difluoropyrrolidin-1-yl)pyrimidine-4-carboximidoyl]-4-(2-methoxyethoxy)cyclohexa-2,4-dien-1-amine.
| Compound Name | 2-[6-(3,3-difluoropyrrolidin-1-yl)pyrimidine-4-carboximidoyl]-4-(2-methoxyethoxy)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123832029 |
| Molecular Formula | C18H23F2N5O2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[6-(3,3-difluoropyrrolidin-1-yl)pyrimidine-4-carboximidoyl]-4-(2-methoxyethoxy)cyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C(/C1=CC(OCCOC)=CCC1N)c1cc(N2CCC(F)(F)C2)ncn1 |
| InChI | InChI=1S/C18H23F2N5O2/c1-26-6-7-27-12-2-3-14(21)13(8-12)17(22)15-9-16(24-11-23-15)25-5-4-18(19,20)10-25/h2,8-9,11,14,22H,3-7,10,21H2,1H3/b22-17- |
| InChIKey | SJFHLGHSGWIHEG-XLNRJJMWSA-N |
| XLogP | 1.89 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|