C24H32N6O3 — CID 123955412
8-[6-[2-amino-5-(1-methoxypropan-2-yloxy)benzenecarboximidoyl]pyrimidin-4-yl]-2-methyl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 123955412) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 8-[6-[2-amino-5-(1-methoxypropan-2-yloxy)benzenecarboximidoyl]pyrimidin-4-yl]-2-methyl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-[6-[2-amino-5-(1-methoxypropan-2-yloxy)benzenecarboximidoyl]pyrimidin-4-yl]-2-methyl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 123955412 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 8-[6-[2-amino-5-(1-methoxypropan-2-yloxy)benzenecarboximidoyl]pyrimidin-4-yl]-2-methyl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | [H]/N=C(/c1cc(N2CCC3(CC2)CC(=O)N(C)C3)ncn1)c1cc(OC(C)COC)ccc1N |
| InChI | InChI=1S/C24H32N6O3/c1-16(13-32-3)33-17-4-5-19(25)18(10-17)23(26)20-11-21(28-15-27-20)30-8-6-24(7-9-30)12-22(31)29(2)14-24/h4-5,10-11,15-16,26H,6-9,12-14,25H2,1-3H3/b26-23+ |
| InChIKey | KXWOBPFOAZEVJJ-WNAAXNPUSA-N |
| XLogP | 2.34 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|