About O-methyl 2-diethoxysilylethanethioate
O-methyl 2-diethoxysilylethanethioate (PubChem CID 123844799) has the molecular formula C7H16O3SSi
and a molecular weight of 208.35 g/mol. Its IUPAC name is O-methyl 2-diethoxysilylethanethioate.
Molecular Properties
| Compound Name | O-methyl 2-diethoxysilylethanethioate |
| PubChem CID | 123844799 |
| Molecular Formula | C7H16O3SSi |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | O-methyl 2-diethoxysilylethanethioate |
| SMILES | CCO[SiH](CC(=S)OC)OCC |
| InChI | InChI=1S/C7H16O3SSi/c1-4-9-12(10-5-2)6-7(11)8-3/h12H,4-6H2,1-3H3 |
| InChIKey | RQUSAXNQJICMKS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl 2-diethoxysilylethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl 2-diethoxysilylethanethioate?
The IUPAC name of O-methyl 2-diethoxysilylethanethioate (CID 123844799) is O-methyl 2-diethoxysilylethanethioate.
What is the SMILES notation for O-methyl 2-diethoxysilylethanethioate?
The canonical SMILES for O-methyl 2-diethoxysilylethanethioate is CCO[SiH](CC(=S)OC)OCC.
What is the InChIKey of O-methyl 2-diethoxysilylethanethioate?
The InChIKey is RQUSAXNQJICMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O3SSi/c1-4-9-12(10-5-2)6-7(11)8-3/h12H,4-6H2,1-3H3.
What are the key properties of O-methyl 2-diethoxysilylethanethioate?
O-methyl 2-diethoxysilylethanethioate has a molecular weight of 208.35 g/mol, XLogP of 1.25, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl 2-diethoxysilylethanethioate is sourced from PubChem (CID 123844799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).