C7H11NO — CID 123850512
(4E)-4-methoxyhexa-1,4-dien-3-imine (PubChem CID 123850512) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (4E)-4-methoxyhexa-1,4-dien-3-imine.
| Compound Name | (4E)-4-methoxyhexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123850512 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (4E)-4-methoxyhexa-1,4-dien-3-imine |
| SMILES | [H]/N=C(C=C)/C(=C\C)OC |
| InChI | InChI=1S/C7H11NO/c1-4-6(8)7(5-2)9-3/h4-5,8H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | BWFRHFYQOJIIJH-KQQUZDAGSA-N |
| XLogP | 1.74 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|