C11H12O6 — CID 123852394
3-(3-hydroxy-7-methyl-5-oxo-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-2-yl)prop-2-enoic acid (PubChem CID 123852394) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-(3-hydroxy-7-methyl-5-oxo-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-2-yl)prop-2-enoic acid.
| Compound Name | 3-(3-hydroxy-7-methyl-5-oxo-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 123852394 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-(3-hydroxy-7-methyl-5-oxo-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-2-yl)prop-2-enoic acid |
| SMILES | CC1OC(=O)C2=CC(O)C(C=CC(=O)O)OC21 |
| InChI | InChI=1S/C11H12O6/c1-5-10-6(11(15)16-5)4-7(12)8(17-10)2-3-9(13)14/h2-5,7-8,10,12H,1H3,(H,13,14) |
| InChIKey | BCXVUJRFPMKNLR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|