C13H20O6 — CID 123594184
6-(5-hydroxy-6-methyl-3-oxooxan-2-yl)oxyhept-2-enoic acid (PubChem CID 123594184) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 6-(5-hydroxy-6-methyl-3-oxooxan-2-yl)oxyhept-2-enoic acid.
| Compound Name | 6-(5-hydroxy-6-methyl-3-oxooxan-2-yl)oxyhept-2-enoic acid |
|---|---|
| PubChem CID | 123594184 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-(5-hydroxy-6-methyl-3-oxooxan-2-yl)oxyhept-2-enoic acid |
| SMILES | CC(CCC=CC(=O)O)OC1OC(C)C(O)CC1=O |
| InChI | InChI=1S/C13H20O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h4,6,8-10,13-14H,3,5,7H2,1-2H3,(H,16,17) |
| InChIKey | VMZLSPFCAOEWMH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|