C17H25F2NO3 — CID 123855093
tert-butyl-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]carbamic acid (PubChem CID 123855093) has the molecular formula C17H25F2NO3 and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]carbamic acid |
|---|---|
| PubChem CID | 123855093 |
| Molecular Formula | C17H25F2NO3 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]carbamic acid |
| SMILES | CC(C)(C)c1c(F)cc(OCCN(C(=O)O)C(C)(C)C)cc1F |
| InChI | InChI=1S/C17H25F2NO3/c1-16(2,3)14-12(18)9-11(10-13(14)19)23-8-7-20(15(21)22)17(4,5)6/h9-10H,7-8H2,1-6H3,(H,21,22) |
| InChIKey | MKKPLEOONPSDJA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |