C15H11NO3 — CID 123865823
spiro[5H-1,3-oxazole-4,9'-xanthene]-3'-ol (PubChem CID 123865823) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is spiro[5H-1,3-oxazole-4,9'-xanthene]-3'-ol.
| Compound Name | spiro[5H-1,3-oxazole-4,9'-xanthene]-3'-ol |
|---|---|
| PubChem CID | 123865823 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | spiro[5H-1,3-oxazole-4,9'-xanthene]-3'-ol |
| SMILES | Oc1ccc2c(c1)Oc1ccccc1C21COC=N1 |
| InChI | InChI=1S/C15H11NO3/c17-10-5-6-12-14(7-10)19-13-4-2-1-3-11(13)15(12)8-18-9-16-15/h1-7,9,17H,8H2 |
| InChIKey | COVZOPLCLVLFQN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |