C14H11NO3 — CID 123661459
spiro[2H-pyrano[3,2-b]chromene-10,4'-5H-1,3-oxazole] (PubChem CID 123661459) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is spiro[2H-pyrano[3,2-b]chromene-10,4'-5H-1,3-oxazole].
| Compound Name | spiro[2H-pyrano[3,2-b]chromene-10,4'-5H-1,3-oxazole] |
|---|---|
| PubChem CID | 123661459 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | spiro[2H-pyrano[3,2-b]chromene-10,4'-5H-1,3-oxazole] |
| SMILES | C1=CC2=C(OC1)C1(COC=N1)c1ccccc1O2 |
| InChI | InChI=1S/C14H11NO3/c1-2-5-11-10(4-1)14(8-16-9-15-14)13-12(18-11)6-3-7-17-13/h1-6,9H,7-8H2 |
| InChIKey | WPLGOAODTHNQHH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |