C21H24N2O2 — CID 123868587
6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaene-6,13-dicarboxamide (PubChem CID 123868587) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaene-6,13-dicarboxamide.
| Compound Name | 6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 123868587 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaene-6,13-dicarboxamide |
| SMILES | CN(C)C(=O)C1=CC2=CC=C3CC(C(=O)N(C)C)=CC=C3CC2C=C1 |
| InChI | InChI=1S/C21H24N2O2/c1-22(2)20(24)18-9-7-14-11-15-8-10-19(21(25)23(3)4)13-17(15)6-5-16(14)12-18/h5-10,12,14H,11,13H2,1-4H3 |
| InChIKey | WPVLJXINMQKNMZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |