C18H20N4OS — CID 123874284
(1-amino-6,7,8,9-tetrahydrothieno[2,3-c]cinnolin-2-yl)-(benzylamino)methanol (PubChem CID 123874284) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is (1-amino-6,7,8,9-tetrahydrothieno[2,3-c]cinnolin-2-yl)-(benzylamino)methanol.
| Compound Name | (1-amino-6,7,8,9-tetrahydrothieno[2,3-c]cinnolin-2-yl)-(benzylamino)methanol |
|---|---|
| PubChem CID | 123874284 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (1-amino-6,7,8,9-tetrahydrothieno[2,3-c]cinnolin-2-yl)-(benzylamino)methanol |
| SMILES | Nc1c(C(O)NCc2ccccc2)sc2nnc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H20N4OS/c19-15-14-12-8-4-5-9-13(12)21-22-18(14)24-16(15)17(23)20-10-11-6-2-1-3-7-11/h1-3,6-7,17,20,23H,4-5,8-10,19H2 |
| InChIKey | CCAMMKBBSQPVPU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|