C29H40N4O6 — CID 123875184
[(2S)-2-[[2-benzyl-8-[[(2S)-1-oxopropan-2-yl]amino]-1-phenyloctan-2-yl]amino]propanoyl]carbamoyloxycarbamic acid (PubChem CID 123875184) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is [(2S)-2-[[2-benzyl-8-[[(2S)-1-oxopropan-2-yl]amino]-1-phenyloctan-2-yl]amino]propanoyl]carbamoyloxycarbamic acid.
| Compound Name | [(2S)-2-[[2-benzyl-8-[[(2S)-1-oxopropan-2-yl]amino]-1-phenyloctan-2-yl]amino]propanoyl]carbamoyloxycarbamic acid |
|---|---|
| PubChem CID | 123875184 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(2S)-2-[[2-benzyl-8-[[(2S)-1-oxopropan-2-yl]amino]-1-phenyloctan-2-yl]amino]propanoyl]carbamoyloxycarbamic acid |
| SMILES | C[C@H](NC(CCCCCCN[C@@H](C)C=O)(Cc1ccccc1)Cc1ccccc1)C(=O)NC(=O)ONC(=O)O |
| InChI | InChI=1S/C29H40N4O6/c1-22(21-34)30-18-12-4-3-11-17-29(19-24-13-7-5-8-14-24,20-25-15-9-6-10-16-25)32-23(2)26(35)31-28(38)39-33-27(36)37/h5-10,13-16,21-23,30,32-33H,3-4,11-12,17-20H2,1-2H3,(H,36,37)(H,31,35,38)/t22-,23-/m0/s1 |
| InChIKey | FPJLTZXZXXGDDG-GOTSBHOMSA-N |
| XLogP | 3.75 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|