C14H26N4O6 — CID 87388641
[(2S)-2-[[1-(carboxyamino)-6-(1-oxopropan-2-ylamino)hexyl]amino]propanoyl]carbamic acid (PubChem CID 87388641) has the molecular formula C14H26N4O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is [(2S)-2-[[1-(carboxyamino)-6-(1-oxopropan-2-ylamino)hexyl]amino]propanoyl]carbamic acid.
| Compound Name | [(2S)-2-[[1-(carboxyamino)-6-(1-oxopropan-2-ylamino)hexyl]amino]propanoyl]carbamic acid |
|---|---|
| PubChem CID | 87388641 |
| Molecular Formula | C14H26N4O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [(2S)-2-[[1-(carboxyamino)-6-(1-oxopropan-2-ylamino)hexyl]amino]propanoyl]carbamic acid |
| SMILES | CC(C=O)NCCCCCC(NC(=O)O)N[C@@H](C)C(=O)NC(=O)O |
| InChI | InChI=1S/C14H26N4O6/c1-9(8-19)15-7-5-3-4-6-11(17-13(21)22)16-10(2)12(20)18-14(23)24/h8-11,15-17H,3-7H2,1-2H3,(H,18,20)(H,21,22)(H,23,24)/t9?,10-,11?/m0/s1 |
| InChIKey | VPSLPTAAGNFJND-YVNMAJEFSA-N |
| XLogP | 0.09 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|