C17H32N4O6 — CID 87388907
[1-[[(2S)-1-(carboxyamino)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]pentyl]carbamic acid (PubChem CID 87388907) has the molecular formula C17H32N4O6 and a molecular weight of 388.47 g/mol. Its IUPAC name is [1-[[(2S)-1-(carboxyamino)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]pentyl]carbamic acid.
| Compound Name | [1-[[(2S)-1-(carboxyamino)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]pentyl]carbamic acid |
|---|---|
| PubChem CID | 87388907 |
| Molecular Formula | C17H32N4O6 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [1-[[(2S)-1-(carboxyamino)-3-methyl-1-oxobutan-2-yl]amino]-5-[(3-methyl-1-oxobutan-2-yl)amino]pentyl]carbamic acid |
| SMILES | CC(C)C(C=O)NCCCCC(NC(=O)O)N[C@H](C(=O)NC(=O)O)C(C)C |
| InChI | InChI=1S/C17H32N4O6/c1-10(2)12(9-22)18-8-6-5-7-13(20-16(24)25)19-14(11(3)4)15(23)21-17(26)27/h9-14,18-20H,5-8H2,1-4H3,(H,21,23)(H,24,25)(H,26,27)/t12?,13?,14-/m0/s1 |
| InChIKey | CTXZSLLERHZGQN-RUXDESIVSA-N |
| XLogP | 0.97 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|